cas: 104104-12-3 — see every product listed under this CAS number, including other names
Bis[2-(4-methoxyphenoxy)ethyl] Ether, >98.0%(GC) (CAS 104104-12-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1479-1G |
| cas | 104104-12-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 310.12 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-methoxy-4-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]benzene (CAS 104104-12-3) is a chemical compound with the molecular formula C18H22O5 and a molecular weight of 318.4 g/mol. IUPAC name: 1-methoxy-4-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]benzene. InChIKey: AJXHXSKQHBJNPB-UHFFFAOYSA-N.
| Molecular formula | C18H22O5 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 1-methoxy-4-[2-[2-(4-methoxyphenoxy)ethoxy]ethoxy]benzene |
| InChIKey | AJXHXSKQHBJNPB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OCCOCCOC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)