cas: 20638-07-7 — see every product listed under this CAS number, including other names
4,4'-(9H-Fluorene-9,9-diyl)bis(2-aminophenol) 98% (CAS 20638-07-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A941765-1g |
| cas | 20638-07-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 10g | 971.12 Pln | |
| Ambeed | 25g | 1688.69 Pln | |
| Ambeed | 100g | 4914.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A941765 |
2-amino-4-[9-(3-amino-4-hydroxyphenyl)fluoren-9-yl]phenol (CAS 20638-07-7) is a chemical compound with the molecular formula C25H20N2O2 and a molecular weight of 380.4 g/mol. IUPAC name: 2-amino-4-[9-(3-amino-4-hydroxyphenyl)fluoren-9-yl]phenol. InChIKey: NLGOBIIKXFNGQR-UHFFFAOYSA-N.
| Molecular formula | C25H20N2O2 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 2-amino-4-[9-(3-amino-4-hydroxyphenyl)fluoren-9-yl]phenol |
| InChIKey | NLGOBIIKXFNGQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(C4=CC(=C(C=C4)O)N)C5=CC(=C(C=C5)O)N |
Computed by PubChem (NCBI)