CAS 1092333-69-1 is the registry number for 2,9-Dimethyl-3,5-diphenyl-7h-furo[3,2-g]chromen-7-one hydrazone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(Z)-(2,9-dimethyl-3,5-diphenylfuro[3,2-g]chromen-7-ylidene)hydrazine (CAS 1092333-69-1) is a chemical compound with the molecular formula C25H20N2O2 and a molecular weight of 380.4 g/mol. IUPAC name: (Z)-(2,9-dimethyl-3,5-diphenylfuro[3,2-g]chromen-7-ylidene)hydrazine. InChIKey: XTWYPDIPGIMTDC-QYQHSDTDSA-N.
| Molecular formula | C25H20N2O2 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (Z)-(2,9-dimethyl-3,5-diphenylfuro[3,2-g]chromen-7-ylidene)hydrazine |
| InChIKey | XTWYPDIPGIMTDC-QYQHSDTDSA-N |
| SMILES | CC1=C2C(=CC3=C1OC(=C3C4=CC=CC=C4)C)C(=C/C(=N/N)/O2)C5=CC=CC=C5 |
Computed by PubChem (NCBI)