cas: 1562777-29-0 — see every product listed under this CAS number, including other names
4,4'-(Anthracene-9,10-diylbis(ethyne-2,1-diyl))dibenzoic acid, 98% (CAS 1562777-29-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F988128-250MG |
| cas | 1562777-29-0 |
| size | 250mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 1g | 393.63 Pln | |
| Fluorochem | 5g | 1554.68 Pln | |
| Fluorochem | 10g | 3012.50 Pln | |
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1499.56 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
4-[2-[10-[2-(4-carboxyphenyl)ethynyl]anthracen-9-yl]ethynyl]benzoic acid (CAS 1562777-29-0) is a chemical compound with the molecular formula C32H18O4 and a molecular weight of 466.5 g/mol. IUPAC name: 4-[2-[10-[2-(4-carboxyphenyl)ethynyl]anthracen-9-yl]ethynyl]benzoic acid. InChIKey: MPEUYAFVSNLHNG-UHFFFAOYSA-N.
| Molecular formula | C32H18O4 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | 4-[2-[10-[2-(4-carboxyphenyl)ethynyl]anthracen-9-yl]ethynyl]benzoic acid |
| InChIKey | MPEUYAFVSNLHNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C#CC4=CC=C(C=C4)C(=O)O)C#CC5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)