CAS 1562777-29-0 appears in our catalog under these names: 4,4'–(Anthracene–9,10–diylbis(ethyne–2,1–diyl))dibenzoic acid, 4,4'-(Anthracene-9,10-diylbis(ethyne-2,1-diyl))dibenzoic acid, 97%, 97%, 4,4'-(Anthracene-9,10-diylbis(ethyne-2,1-diyl))dibenzoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 15g, 25g, 50g.
4-[2-[10-[2-(4-carboxyphenyl)ethynyl]anthracen-9-yl]ethynyl]benzoic acid (CAS 1562777-29-0) is a chemical compound with the molecular formula C32H18O4 and a molecular weight of 466.5 g/mol. IUPAC name: 4-[2-[10-[2-(4-carboxyphenyl)ethynyl]anthracen-9-yl]ethynyl]benzoic acid. InChIKey: MPEUYAFVSNLHNG-UHFFFAOYSA-N.
| Molecular formula | C32H18O4 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | 4-[2-[10-[2-(4-carboxyphenyl)ethynyl]anthracen-9-yl]ethynyl]benzoic acid |
| InChIKey | MPEUYAFVSNLHNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C#CC4=CC=C(C=C4)C(=O)O)C#CC5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)