cas: 7418-16-8 — see every product listed under this CAS number, including other names
4,4'-(Propane-2,2-diyl)dicyclohexanone, 95%, 95% (CAS 7418-16-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F0X-1g |
| cas | 7418-16-8 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 515.60 Pln | |
| Chemat | 10g | 794.00 Pln | |
| Chemat | 25g | 1528.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[2-(4-oxocyclohexyl)propan-2-yl]cyclohexan-1-one (CAS 7418-16-8) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: 4-[2-(4-oxocyclohexyl)propan-2-yl]cyclohexan-1-one. InChIKey: HAWVCXABNZBPED-UHFFFAOYSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | 4-[2-(4-oxocyclohexyl)propan-2-yl]cyclohexan-1-one |
| InChIKey | HAWVCXABNZBPED-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CCC(=O)CC1)C2CCC(=O)CC2 |
Computed by PubChem (NCBI)