cas: 5314-37-4 — see every product listed under this CAS number, including other names
4,4'-Biphenyldisulfonic Acid 98% (CAS 5314-37-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A699811-1g |
| cas | 5314-37-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 531.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A699811 |
4-(4-sulfophenyl)benzenesulfonic acid (CAS 5314-37-4) is a chemical compound with the molecular formula C12H10O6S2 and a molecular weight of 314.3 g/mol. IUPAC name: 4-(4-sulfophenyl)benzenesulfonic acid. InChIKey: ABSXMLODUTXQDJ-UHFFFAOYSA-N.
| Molecular formula | C12H10O6S2 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 4-(4-sulfophenyl)benzenesulfonic acid |
| InChIKey | ABSXMLODUTXQDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)