CAS 5314-37-4 appears in our catalog under these names: 4,4'-Biphenyldisulfonic acid, 98%, 4,4'–Biphenyldisulfonic Acid, 4,4'-Biphenyldisulfonic acid, 4,4'-Biphenyldisulfonic Acid, >98.0%(T), 4,4'-Biphenyldisulfonic Acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 1g, 25g, 5g, 100g.
4-(4-sulfophenyl)benzenesulfonic acid (CAS 5314-37-4) is a chemical compound with the molecular formula C12H10O6S2 and a molecular weight of 314.3 g/mol. IUPAC name: 4-(4-sulfophenyl)benzenesulfonic acid. InChIKey: ABSXMLODUTXQDJ-UHFFFAOYSA-N.
| Molecular formula | C12H10O6S2 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 4-(4-sulfophenyl)benzenesulfonic acid |
| InChIKey | ABSXMLODUTXQDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)