cas: 4129-44-6 — see every product listed under this CAS number, including other names
4,4'-Bis(diphenylphosphanyl)-1,1'-biphenyl 98% (CAS 4129-44-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1146430-250mg |
| cas | 4129-44-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1221.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1146430 |
[4-(4-diphenylphosphanylphenyl)phenyl]-diphenylphosphane (CAS 4129-44-6) is a chemical compound with the molecular formula C36H28P2 and a molecular weight of 522.6 g/mol. IUPAC name: [4-(4-diphenylphosphanylphenyl)phenyl]-diphenylphosphane. InChIKey: RJUKHLSOORRJLL-UHFFFAOYSA-N.
| Molecular formula | C36H28P2 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | [4-(4-diphenylphosphanylphenyl)phenyl]-diphenylphosphane |
| InChIKey | RJUKHLSOORRJLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)P(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)