4,4'-Diethynyl-2,2'-bipyridine, 95%
cas: 133810-44-3 — see every product listed under this CAS number, including other names
4,4'-Diethynyl-2,2'-bipyridine, 95% (CAS 133810-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1323847-100mg |
| cas | 133810-44-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 882.12 Pln | |
| Ambeed | 5g | 2901.31 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 397.66 Pln | |
| BLDpharm | 1g | 941.92 Pln | |
| BLDpharm | 5g | 3124.48 Pln | |
| Fluorochem | 100mg | 148.92 Pln | |
| Fluorochem | 250mg | 211.40 Pln | |
| Fluorochem | 1g | 653.95 Pln | |
| Fluorochem | 5g | 2903.16 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-ethynyl-2-(4-ethynyl-2-pyridinyl)pyridine (CAS 133810-44-3) is a chemical compound with the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. IUPAC name: 4-ethynyl-2-(4-ethynyl-2-pyridinyl)pyridine. InChIKey: VRZUWDJLVOHARA-UHFFFAOYSA-N.
| Molecular formula | C14H8N2 |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 4-ethynyl-2-(4-ethynyl-2-pyridinyl)pyridine |
| InChIKey | VRZUWDJLVOHARA-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=NC=C1)C2=NC=CC(=C2)C#C |
Computed by PubChem (NCBI)