cas: 1189458-67-0 — see every product listed under this CAS number, including other names
4,4'-Difluoro-2,2'-bipyridine, 97%, 97% (CAS 1189458-67-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FT74-50mg |
| cas | 1189458-67-0 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 338.00 Pln | |
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 894.80 Pln | |
| Chemat | 1g | 2296.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-fluoro-2-(4-fluoro-2-pyridinyl)pyridine (CAS 1189458-67-0) is a chemical compound with the molecular formula C10H6F2N2 and a molecular weight of 192.16 g/mol. IUPAC name: 4-fluoro-2-(4-fluoro-2-pyridinyl)pyridine. InChIKey: MKQUGHDXOCXHMY-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2 |
|---|---|
| Molecular weight | 192.16 g/mol |
| IUPAC name | 4-fluoro-2-(4-fluoro-2-pyridinyl)pyridine |
| InChIKey | MKQUGHDXOCXHMY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1F)C2=NC=CC(=C2)F |
Computed by PubChem (NCBI)