4,4'-Difluoro-2,2'-bipyridine, 98%
cas: 1189458-67-0 — see every product listed under this CAS number, including other names
4,4'-Difluoro-2,2'-bipyridine, 98% (CAS 1189458-67-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F540479-50MG |
| cas | 1189458-67-0 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 435.28 Pln | |
| Fluorochem | 100mg | 607.10 Pln | |
| Fluorochem | 250mg | 1080.89 Pln | |
| Fluorochem | 1g | 3731.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-fluoro-2-(4-fluoro-2-pyridinyl)pyridine (CAS 1189458-67-0) is a chemical compound with the molecular formula C10H6F2N2 and a molecular weight of 192.16 g/mol. IUPAC name: 4-fluoro-2-(4-fluoro-2-pyridinyl)pyridine. InChIKey: MKQUGHDXOCXHMY-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2 |
|---|---|
| Molecular weight | 192.16 g/mol |
| IUPAC name | 4-fluoro-2-(4-fluoro-2-pyridinyl)pyridine |
| InChIKey | MKQUGHDXOCXHMY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1F)C2=NC=CC(=C2)F |
Computed by PubChem (NCBI)