cas: 18970-30-4 — see every product listed under this CAS number, including other names
4,4'-Diisopropylbiphenyl (CAS 18970-30-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2047-25G |
| cas | 18970-30-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 315.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
1-propan-2-yl-4-(4-propan-2-ylphenyl)benzene (CAS 18970-30-4) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1-propan-2-yl-4-(4-propan-2-ylphenyl)benzene. InChIKey: NUEUMFZLNOCRCQ-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1-propan-2-yl-4-(4-propan-2-ylphenyl)benzene |
| InChIKey | NUEUMFZLNOCRCQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)C |
Computed by PubChem (NCBI)