cas: 1813554-40-3 — see every product listed under this CAS number, including other names
4,4,5,5-TETRAMETHYL-2-(4-((4-(TRIFLUOROMETHYL)BENZYL)OXY)PHENYL)-1,3,2-DIOXABOROLANE, 97% (CAS 1813554-40-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F817597-100MG |
| cas | 1813554-40-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1008.00 Pln | |
| Fluorochem | 5g | 3199.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane (CAS 1813554-40-3) is a chemical compound with the molecular formula C20H22BF3O3 and a molecular weight of 378.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane. InChIKey: WWHKUPQIPGDPFH-UHFFFAOYSA-N.
| Molecular formula | C20H22BF3O3 |
|---|---|
| Molecular weight | 378.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane |
| InChIKey | WWHKUPQIPGDPFH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)