4,4,5,5-Tetramethyl-2-(4-((4-(trifluoromethyl)phenyl)methoxy)phenyl)-1,3,2-dioxaborolane, ≥97-<99%
cas: 1813554-40-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-((4-(trifluoromethyl)phenyl)methoxy)phenyl)-1,3,2-dioxaborolane, ≥97-<99% (CAS 1813554-40-3) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC943-97-99-2.5g |
| cas | 1813554-40-3 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 4429.48 Pln | |
| Hoffman Fine Chemicals | 5g | 8072.46 Pln | |
| Hoffman Fine Chemicals | 10g | 12723.48 Pln | |
| Hoffman Fine Chemicals | 25g | 25138.96 Pln | |
| Hoffman Fine Chemicals | 50g | 40036.26 Pln |
properties
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane (CAS 1813554-40-3) is a chemical compound with the molecular formula C20H22BF3O3 and a molecular weight of 378.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane. InChIKey: WWHKUPQIPGDPFH-UHFFFAOYSA-N.
| Molecular formula | C20H22BF3O3 |
|---|---|
| Molecular weight | 378.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3,2-dioxaborolane |
| InChIKey | WWHKUPQIPGDPFH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)