cas: 347389-75-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(1-propyn-1-YL)-1,3,2-dioxaborolane, 95%, 95% (CAS 347389-75-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C0LL-5g |
| cas | 347389-75-7 |
| size | 5g |
| availability | 9.155g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 3760.40 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-prop-1-ynyl-1,3,2-dioxaborolane (CAS 347389-75-7) is a chemical compound with the molecular formula C9H15BO2 and a molecular weight of 166.03 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-prop-1-ynyl-1,3,2-dioxaborolane. InChIKey: FDQYQNRFYLSJOP-UHFFFAOYSA-N.
| Molecular formula | C9H15BO2 |
|---|---|
| Molecular weight | 166.03 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-prop-1-ynyl-1,3,2-dioxaborolane |
| InChIKey | FDQYQNRFYLSJOP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CC |
Computed by PubChem (NCBI)