CAS 347389-75-7 appears in our catalog under these names: Prop-1-ynylboronic acid pinacol ester, 96%, 4,4,5,5-Tetramethyl-2-(prop-1-yn-1-yl)-1,3,2-dioxaborolane, 98%, Prop-1-ynylboronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(prop-1-yn-1-yl)-1,3,2-dioxaborolane 97%, 4,4,5,5-Tetramethyl-2-(1-propyn-1-YL)-1,3,2-dioxaborolane, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 10g, 5g, 2g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-prop-1-ynyl-1,3,2-dioxaborolane (CAS 347389-75-7) is a chemical compound with the molecular formula C9H15BO2 and a molecular weight of 166.03 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-prop-1-ynyl-1,3,2-dioxaborolane. InChIKey: FDQYQNRFYLSJOP-UHFFFAOYSA-N.
| Molecular formula | C9H15BO2 |
|---|---|
| Molecular weight | 166.03 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-prop-1-ynyl-1,3,2-dioxaborolane |
| InChIKey | FDQYQNRFYLSJOP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CC |
Computed by PubChem (NCBI)