4,4,5,5-Tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane, 97%
cas: 1073339-11-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane, 97% (CAS 1073339-11-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F546762-100MG |
| cas | 1073339-11-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2378.44 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 775.31 Pln | |
| BLDpharm | 5g | 2558.01 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4,4,5,5-tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane (CAS 1073339-11-3) is a chemical compound with the molecular formula C12H13BF4O2 and a molecular weight of 276.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane. InChIKey: MSEFKALUUBYZOK-UHFFFAOYSA-N.
| Molecular formula | C12H13BF4O2 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane |
| InChIKey | MSEFKALUUBYZOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC(=C2F)F)F)F |
Computed by PubChem (NCBI)