CAS 1111096-18-4 is the registry number for 2,3,4,6-Tetrafluorophenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4,4,5,5-tetramethyl-2-(2,3,4,6-tetrafluorophenyl)-1,3,2-dioxaborolane (CAS 1111096-18-4) is a chemical compound with the molecular formula C12H13BF4O2 and a molecular weight of 276.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,3,4,6-tetrafluorophenyl)-1,3,2-dioxaborolane. InChIKey: DOMOGOUPBJPOIB-UHFFFAOYSA-N.
| Molecular formula | C12H13BF4O2 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,3,4,6-tetrafluorophenyl)-1,3,2-dioxaborolane |
| InChIKey | DOMOGOUPBJPOIB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2F)F)F)F |
Computed by PubChem (NCBI)