cas: 1073339-21-5 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2-(Trifluoromethyl)Phenyl)-1,3,2-Dioxaborolane, 98%, 98% (CAS 1073339-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119WPF-250mg |
| cas | 1073339-21-5 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 314.00 Pln | |
| Chemat | 25g | 674.00 Pln | |
| Chemat | 50g | 1278.80 Pln | |
| Chemat | 100g | 2488.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-[2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 1073339-21-5) is a chemical compound with the molecular formula C13H16BF3O2 and a molecular weight of 272.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: HBQNDHPCMDZKNT-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O2 |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | HBQNDHPCMDZKNT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)