cas: 325142-82-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-(trifluoromethyl)phenyl)-1,3,2-dioxaborolane 98% (CAS 325142-82-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114283-250mg |
| cas | 325142-82-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 809.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A114283 |
4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 325142-82-3) is a chemical compound with the molecular formula C13H16BF3O2 and a molecular weight of 272.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: GJNOCGLTCQPYAC-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O2 |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | GJNOCGLTCQPYAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)