cas: 325142-82-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-trifluoromethylphenyl)-1,3,2-dioxaborolane, 95% (CAS 325142-82-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021835-250MG |
| cas | 325142-82-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 284.29 Pln | |
| Fluorochem | 100g | 794.53 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 325142-82-3) is a chemical compound with the molecular formula C13H16BF3O2 and a molecular weight of 272.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: GJNOCGLTCQPYAC-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O2 |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | GJNOCGLTCQPYAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)