cas: 214360-65-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-(trifluoromethyl)phenyl)-1,3,2-dioxaborolane, 98%, 98% (CAS 214360-65-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I567-1g |
| cas | 214360-65-3 |
| size | 1g |
| availability | 736.11g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 100g | 458.00 Pln | |
| Chemat | 500g | 1910.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 214360-65-3) is a chemical compound with the molecular formula C13H16BF3O2 and a molecular weight of 272.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: GCQADNWXVSTJQW-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O2 |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | GCQADNWXVSTJQW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)