cas: 1810767-17-9 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-nitro-2-(trifluoromethyl)phenyl)-1,3,2-dioxaborolane, 97% (CAS 1810767-17-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691844-1G |
| cas | 1810767-17-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 440.49 Pln | |
| Fluorochem | 5g | 1388.07 Pln | |
| Fluorochem | 10g | 2715.73 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[4-nitro-2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 1810767-17-9) is a chemical compound with the molecular formula C13H15BF3NO4 and a molecular weight of 317.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-nitro-2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: DEDLDBFSBFSSPH-UHFFFAOYSA-N.
| Molecular formula | C13H15BF3NO4 |
|---|---|
| Molecular weight | 317.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-nitro-2-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | DEDLDBFSBFSSPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)