CAS 2096337-98-1 is the registry number for 3-Nitro-5-(trifluoromethyl)phenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,4,5,5-tetramethyl-2-[3-nitro-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane (CAS 2096337-98-1) is a chemical compound with the molecular formula C13H15BF3NO4 and a molecular weight of 317.07 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-nitro-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: RITSVJLBVKIVBN-UHFFFAOYSA-N.
| Molecular formula | C13H15BF3NO4 |
|---|---|
| Molecular weight | 317.07 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-nitro-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | RITSVJLBVKIVBN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)