cas: 269410-26-6 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-phenoxyphenyl)-1,3,2-dioxaborolane 97% (CAS 269410-26-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117971-500g |
| cas | 269410-26-6 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 1977.94 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 548.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A117971 |
4,4,5,5-tetramethyl-2-(4-phenoxyphenyl)-1,3,2-dioxaborolane (CAS 269410-26-6) is a chemical compound with the molecular formula C18H21BO3 and a molecular weight of 296.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenoxyphenyl)-1,3,2-dioxaborolane. InChIKey: SFCRPRMZQXUXOG-UHFFFAOYSA-N.
| Molecular formula | C18H21BO3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-phenoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | SFCRPRMZQXUXOG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)