cas: 269410-26-6 — see every product listed under this CAS number, including other names
Phenoxyphenyl-4-boronic acid pinacol ester, 97% (CAS 269410-26-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092452-25G |
| cas | 269410-26-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 174.96 Pln | |
| Fluorochem | 100g | 497.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(4-phenoxyphenyl)-1,3,2-dioxaborolane (CAS 269410-26-6) is a chemical compound with the molecular formula C18H21BO3 and a molecular weight of 296.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenoxyphenyl)-1,3,2-dioxaborolane. InChIKey: SFCRPRMZQXUXOG-UHFFFAOYSA-N.
| Molecular formula | C18H21BO3 |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-phenoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | SFCRPRMZQXUXOG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)