4,4,5,5-Tetramethyl-2-(4-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane, 97%
cas: 1422181-38-1 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane, 97% (CAS 1422181-38-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F867663-250MG |
| cas | 1422181-38-1 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 617.51 Pln | |
| Fluorochem | 5g | 1919.13 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1366.06 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1326.80 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 475.41 Pln | |
| BLDpharm | 5g | 1469.51 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4,4,5,5-tetramethyl-2-(4-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 1422181-38-1) is a chemical compound with the molecular formula C22H23BO2 and a molecular weight of 330.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: UPKOBWKHLOCATC-UHFFFAOYSA-N.
| Molecular formula | C22H23BO2 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | UPKOBWKHLOCATC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5-tetramethyl-2-(4-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-(1-phenylnaphthalen-4-yl)-1,3,2-dioxaborolane, 4-Phenylnaphthalene-1-boronic Acid Pinacol Ester, 4,4,5,5-tetramethyl-2-(4-phenyl-1-naphthyl)-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-(4-phenyl-1-naphthalenyl)-1,3,2-dioxaborolane