CAS 612086-25-6 is the registry number for 4,4,5,5-Tetramethyl-2-(2-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane, 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4,4,5,5-tetramethyl-2-(2-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 612086-25-6) is a chemical compound with the molecular formula C22H23BO2 and a molecular weight of 330.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: CAOAQAHSNPQOGG-UHFFFAOYSA-N.
| Molecular formula | C22H23BO2 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-phenylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | CAOAQAHSNPQOGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC3=CC=CC=C23)C4=CC=CC=C4 |
Computed by PubChem (NCBI)