cas: 2096334-45-9 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-propylcyclohex-1-en-1-yl)-1,3,2-dioxaborolane 98% (CAS 2096334-45-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1219710-250mg |
| cas | 2096334-45-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1219710 |
4,4,5,5-tetramethyl-2-(4-propylcyclohexen-1-yl)-1,3,2-dioxaborolane (CAS 2096334-45-9) is a chemical compound with the molecular formula C15H27BO2 and a molecular weight of 250.19 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-propylcyclohexen-1-yl)-1,3,2-dioxaborolane. InChIKey: AALBRBHEPBSUPZ-UHFFFAOYSA-N.
| Molecular formula | C15H27BO2 |
|---|---|
| Molecular weight | 250.19 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-propylcyclohexen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | AALBRBHEPBSUPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)CCC |
Computed by PubChem (NCBI)