cas: 475250-57-8 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(naphthalen-1-ylmethyl)-1,3,2-dioxaborolane 95% (CAS 475250-57-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A349314-1g |
| cas | 475250-57-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 1171.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A349314 |
4,4,5,5-tetramethyl-2-(naphthalen-1-ylmethyl)-1,3,2-dioxaborolane (CAS 475250-57-8) is a chemical compound with the molecular formula C17H21BO2 and a molecular weight of 268.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(naphthalen-1-ylmethyl)-1,3,2-dioxaborolane. InChIKey: VYMBZQMGIGIALJ-UHFFFAOYSA-N.
| Molecular formula | C17H21BO2 |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(naphthalen-1-ylmethyl)-1,3,2-dioxaborolane |
| InChIKey | VYMBZQMGIGIALJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)