CAS 312303-48-3 appears in our catalog under these names: 2-Methylnaphthalene-1-boronic acid pinacol ester, 95-<97%, 2-Methylnaphthalene-1-boronic acid pinacol ester, ≥97-<99%, 2–Methylnaphthalene–1–boronic Acid Pinacol Ester, 4,4,5,5-Tetramethyl-2-(2-methylnaphthalen-1-yl)-1,3,2-dioxaborolane 95%, 4,4,5,5-tetramethyl-2-(2-methylnaphthalen-1-yl)-1,3,2-dioxaborolane, 97%, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 250mg, 5g, 100mg, 1g.
4,4,5,5-tetramethyl-2-(2-methylnaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 312303-48-3) is a chemical compound with the molecular formula C17H21BO2 and a molecular weight of 268.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylnaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: GEFOXHSKBXZYNQ-UHFFFAOYSA-N.
| Molecular formula | C17H21BO2 |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | GEFOXHSKBXZYNQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC3=CC=CC=C23)C |
Computed by PubChem (NCBI)