CAS 1396215-84-1 appears in our catalog under these names: 4,4,5,5–Tetramethyl–2–(oxetan–3–yl)–1,3,2–dioxaborolane, 4,4,5,5-tetramethyl-2-(oxetan-3-yl)-1,3,2-dioxaborolane, 97%, 97%, 4,4,5,5-Tetramethyl-2-(oxetan-3-yl)-1,3,2-dioxaborolane, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g, 50g, 500mg.
4,4,5,5-tetramethyl-2-(oxetan-3-yl)-1,3,2-dioxaborolane (CAS 1396215-84-1) is a chemical compound with the molecular formula C9H17BO3 and a molecular weight of 184.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxetan-3-yl)-1,3,2-dioxaborolane. InChIKey: LBABXQQSDMILIX-UHFFFAOYSA-N.
| Molecular formula | C9H17BO3 |
|---|---|
| Molecular weight | 184.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxetan-3-yl)-1,3,2-dioxaborolane |
| InChIKey | LBABXQQSDMILIX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2COC2 |
Computed by PubChem (NCBI)