Products 1402845-34-4
CAS 1402845-34-4 is the registry number for (2,2,6,6-Tetramethyl-3,6-dihydro-2H-pyran-4-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,2,6,6-tetramethyl-3H-pyran-4-yl)boronic acid (CAS 1402845-34-4) is a chemical compound with the molecular formula C9H17BO3 and a molecular weight of 184.04 g/mol. IUPAC name: (2,2,6,6-tetramethyl-3H-pyran-4-yl)boronic acid. InChIKey: KAKGNSUAOVSFMY-UHFFFAOYSA-N.
| Molecular formula | C9H17BO3 |
|---|---|
| Molecular weight | 184.04 g/mol |
| IUPAC name | (2,2,6,6-tetramethyl-3H-pyran-4-yl)boronic acid |
| InChIKey | KAKGNSUAOVSFMY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(OC(C1)(C)C)(C)C)(O)O |
Computed by PubChem (NCBI)