cas: 865350-17-0 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(propa-1,2-dien-1-yl)-1,3,2-dioxaborolane (CAS 865350-17-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209411-250MG |
| cas | 865350-17-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 893.45 Pln |
| delivery time | 3-4 weeks |
|---|
4,4,5,5-tetramethyl-2-propa-1,2-dienyl-1,3,2-dioxaborolane (CAS 865350-17-0) is a chemical compound with the molecular formula C9H15BO2 and a molecular weight of 166.03 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-propa-1,2-dienyl-1,3,2-dioxaborolane. InChIKey: CJAOMXUZZONOSD-UHFFFAOYSA-N.
| Molecular formula | C9H15BO2 |
|---|---|
| Molecular weight | 166.03 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-propa-1,2-dienyl-1,3,2-dioxaborolane |
| InChIKey | CJAOMXUZZONOSD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C=C |
Computed by PubChem (NCBI)