cas: 912569-55-2 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-[2-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane, 97% (CAS 912569-55-2) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC58539CB |
| cas | 912569-55-2 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 327.85 Pln | |
| Thermo Scientific | 1g | 814.53 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4,4,5,5-tetramethyl-2-[2-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane (CAS 912569-55-2) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: DTPMFYHICLWUGJ-UHFFFAOYSA-N.
| Molecular formula | C19H23BO3 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | DTPMFYHICLWUGJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2COC3=CC=CC=C3 |
Computed by PubChem (NCBI)