cas: 1011460-68-6 — see every product listed under this CAS number, including other names
4,4,6-Trimethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborinane, 97%, 97% (CAS 1011460-68-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250g, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1114U0-100mg |
| cas | 1011460-68-6 |
| size | 100mg |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250g | 3165.20 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 443.60 Pln | |
| Chemat | 50g | 750.80 Pln | |
| Chemat | 100g | 1341.20 Pln | |
| Chemat | 500g | 5990.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,4,6-trimethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborinane (CAS 1011460-68-6) is a chemical compound with the molecular formula C9H14BF3O2 and a molecular weight of 222.01 g/mol. IUPAC name: 4,4,6-trimethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborinane. InChIKey: GGSSZVWESZQFOZ-UHFFFAOYSA-N.
| Molecular formula | C9H14BF3O2 |
|---|---|
| Molecular weight | 222.01 g/mol |
| IUPAC name | 4,4,6-trimethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborinane |
| InChIKey | GGSSZVWESZQFOZ-UHFFFAOYSA-N |
| SMILES | B1(OC(CC(O1)(C)C)C)C(=C)C(F)(F)F |
Computed by PubChem (NCBI)