CAS 1055881-27-0 appears in our catalog under these names: 1-(Trifluoromethyl)ethenylboronic acid, pinacol ester, 4,4,5,5-Tetramethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborolane 95% (stabilized with TBC), 4,4,5,5-Tetramethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborolane, 95% (stabilized with TBC), 95% (stabilized with TBC). Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborolane (CAS 1055881-27-0) is a chemical compound with the molecular formula C9H14BF3O2 and a molecular weight of 222.01 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborolane. InChIKey: XIHQTEZBKPUQTH-UHFFFAOYSA-N.
| Molecular formula | C9H14BF3O2 |
|---|---|
| Molecular weight | 222.01 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborolane |
| InChIKey | XIHQTEZBKPUQTH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C(F)(F)F |
Computed by PubChem (NCBI)