cas: 123847-85-8 — see every product listed under this CAS number, including other names
4,4‚Ä≤-Bis(N-(1-naphthyl)-N-phenylamino)biphenyl, ≥97-<99% (CAS 123847-85-8) is a chemical reagent available from Chemat. Available pack sizes: 200g, 300g, 400g, 500g, 600g, 700g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC626-97-99-200g |
| cas | 123847-85-8 |
| size | 200g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 200g | 5182.32 Pln | |
| Hoffman Fine Chemicals | 300g | 6158.46 Pln | |
| Hoffman Fine Chemicals | 400g | 6936.82 Pln | |
| Hoffman Fine Chemicals | 500g | 7766.22 Pln | |
| Hoffman Fine Chemicals | 600g | 8359.56 Pln | |
| Hoffman Fine Chemicals | 700g | 8767.88 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
N-[4-[4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine (CAS 123847-85-8) is a chemical compound with the molecular formula C44H32N2 and a molecular weight of 588.7 g/mol. IUPAC name: N-[4-[4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine. InChIKey: IBHBKWKFFTZAHE-UHFFFAOYSA-N.
| Molecular formula | C44H32N2 |
|---|---|
| Molecular weight | 588.7 g/mol |
| IUPAC name | N-[4-[4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine |
| InChIKey | IBHBKWKFFTZAHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC6=CC=CC=C65)C7=CC=CC8=CC=CC=C87 |
Computed by PubChem (NCBI)