cas: 123847-85-8 — see every product listed under this CAS number, including other names
N,N'-Biphenyl-N,N'-bis-(1-naphthenyl)-[1,1'-biphenyl]-4,4'-diamine, 98%, 98% (CAS 123847-85-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148WQ-1g |
| cas | 123847-85-8 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 462.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[4-[4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine (CAS 123847-85-8) is a chemical compound with the molecular formula C44H32N2 and a molecular weight of 588.7 g/mol. IUPAC name: N-[4-[4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine. InChIKey: IBHBKWKFFTZAHE-UHFFFAOYSA-N.
| Molecular formula | C44H32N2 |
|---|---|
| Molecular weight | 588.7 g/mol |
| IUPAC name | N-[4-[4-(N-naphthalen-1-ylanilino)phenyl]phenyl]-N-phenylnaphthalen-1-amine |
| InChIKey | IBHBKWKFFTZAHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC6=CC=CC=C65)C7=CC=CC8=CC=CC=C87 |
Computed by PubChem (NCBI)