cas: 438017-43-7 — see every product listed under this CAS number, including other names
4,4-Difluorotricyclo[3.3.1.13,7]decane-1-carboxylic acid, 95+%, 95+% (CAS 438017-43-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DIIA-50mg |
| cas | 438017-43-7 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 640.40 Pln | |
| Chemat | 100mg | 1053.20 Pln | |
| Chemat | 250mg | 1821.20 Pln | |
| Chemat | 1g | 5320.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
4,4-difluoroadamantane-1-carboxylic acid (CAS 438017-43-7) is a chemical compound with the molecular formula C11H14F2O2 and a molecular weight of 216.22 g/mol. IUPAC name: 4,4-difluoroadamantane-1-carboxylic acid. InChIKey: STPITGHNDOOTFQ-UHFFFAOYSA-N.
| Molecular formula | C11H14F2O2 |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | 4,4-difluoroadamantane-1-carboxylic acid |
| InChIKey | STPITGHNDOOTFQ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC(C2)(CC1C3(F)F)C(=O)O |
Computed by PubChem (NCBI)