CAS 438017-43-7 appears in our catalog under these names: 4,4-Difluoroadamantane-1-carboxylic acid, 95%, 4,4–DIFLUOROADAMANTANE–1–CARBOXYLIC ACID, 4,4-difluoroadamantane-1-carboxylic acid, 4,4-Difluoroadamantane-1-carboxylic acid 95+%, 4,4-Difluorotricyclo[3.3.1.13,7]decane-1-carboxylic acid, 95+%, 95+%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
4,4-difluoroadamantane-1-carboxylic acid (CAS 438017-43-7) is a chemical compound with the molecular formula C11H14F2O2 and a molecular weight of 216.22 g/mol. IUPAC name: 4,4-difluoroadamantane-1-carboxylic acid. InChIKey: STPITGHNDOOTFQ-UHFFFAOYSA-N.
| Molecular formula | C11H14F2O2 |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | 4,4-difluoroadamantane-1-carboxylic acid |
| InChIKey | STPITGHNDOOTFQ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC(C2)(CC1C3(F)F)C(=O)O |
Computed by PubChem (NCBI)