cas: 219489-09-5 — see every product listed under this CAS number, including other names
4,4-Dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one, 96% (CAS 219489-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694533-100MG |
| cas | 219489-09-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 706.02 Pln | |
| Fluorochem | 1g | 1705.67 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one (CAS 219489-09-5) is a chemical compound with the molecular formula C14H23BO3 and a molecular weight of 250.14 g/mol. IUPAC name: 4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one. InChIKey: MMYLPQABFZSMCP-UHFFFAOYSA-N.
| Molecular formula | C14H23BO3 |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | 4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-2-en-1-one |
| InChIKey | MMYLPQABFZSMCP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(CCC2=O)(C)C |
Computed by PubChem (NCBI)