cas: 1556315-73-1 — see every product listed under this CAS number, including other names
4,5,6,7-Tetrahydropyrazolo[1,5-a]pyridine-7-carboxylic acid, 98%, 98% (CAS 1556315-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DVNO-100mg |
| cas | 1556315-73-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1274.00 Pln | |
| Chemat | 250mg | 1792.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-7-carboxylic acid (CAS 1556315-73-1) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-7-carboxylic acid. InChIKey: AZTZOVYXLBVKMO-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-7-carboxylic acid |
| InChIKey | AZTZOVYXLBVKMO-UHFFFAOYSA-N |
| SMILES | C1CC(N2C(=CC=N2)C1)C(=O)O |
Computed by PubChem (NCBI)