cas: 886362-21-6 — see every product listed under this CAS number, including other names
4,6-DICHLORO-2-METHYLINDOLE, 98%, 98% (CAS 886362-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119AN2-100mg |
| cas | 886362-21-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 707.60 Pln | |
| Chemat | 500mg | 1158.80 Pln | |
| Chemat | 1g | 1634.00 Pln | |
| Chemat | 5g | 6016.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,6-dichloro-2-methyl-1H-indole (CAS 886362-21-6) is a chemical compound with the molecular formula C9H7Cl2N and a molecular weight of 200.06 g/mol. IUPAC name: 4,6-dichloro-2-methyl-1H-indole. InChIKey: UCUSJGONHVYQIE-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N |
|---|---|
| Molecular weight | 200.06 g/mol |
| IUPAC name | 4,6-dichloro-2-methyl-1H-indole |
| InChIKey | UCUSJGONHVYQIE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)