CAS 55377-25-8 is the registry number for 6-Chloroquinoline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
6-chloroquinoline;hydrochloride (CAS 55377-25-8) is a chemical compound with the molecular formula C9H7Cl2N and a molecular weight of 200.06 g/mol. IUPAC name: 6-chloroquinoline;hydrochloride. InChIKey: QBYRZXJQQVDKAU-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N |
|---|---|
| Molecular weight | 200.06 g/mol |
| IUPAC name | 6-chloroquinoline;hydrochloride |
| InChIKey | QBYRZXJQQVDKAU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Cl)N=C1.Cl |
Computed by PubChem (NCBI)