cas: 948292-34-0 — see every product listed under this CAS number, including other names
4,6-Dichloro-8-methylquinoline, 97%, 97% (CAS 948292-34-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117S1O-100mg |
| cas | 948292-34-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 1902.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,6-dichloro-8-methylquinoline (CAS 948292-34-0) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 4,6-dichloro-8-methylquinoline. InChIKey: UQFDVOVNYBYJJY-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 4,6-dichloro-8-methylquinoline |
| InChIKey | UQFDVOVNYBYJJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C(C=CN=C12)Cl)Cl |
Computed by PubChem (NCBI)