CAS 26933-09-5 appears in our catalog under these names: 5,7-Dichloro-2-methylquinoline, 98%, 5,7-Dichloro-2-methylquinoline, 95%, 5,7–Dichloro–2–methylquinoline. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 25g, 5g.
5,7-dichloro-2-methylquinoline (CAS 26933-09-5) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 5,7-dichloro-2-methylquinoline. InChIKey: HOGMFBWKANERDP-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 5,7-dichloro-2-methylquinoline |
| InChIKey | HOGMFBWKANERDP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)