cas: 1609394-50-4 — see every product listed under this CAS number, including other names
4,6-Dichloropyridazine-3-carboxamide, 95% (CAS 1609394-50-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1002865-250mg |
| cas | 1609394-50-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1377.19 Pln | |
| Chemat | 100mg | 563.60 Pln | |
| Chemat | 250mg | 1014.80 Pln | |
| Chemat | 1g | 2310.80 Pln | |
| Chemat | 5g | 5603.60 Pln | |
| BLDpharm | 100mg | 819.74 Pln | |
| BLDpharm | 250mg | 1480.61 Pln | |
| BLDpharm | 1g | 3407.71 Pln | |
| BLDpharm | 5g | 8289.33 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4,6-dichloropyridazine-3-carboxamide (CAS 1609394-50-4) is a chemical compound with the molecular formula C5H3Cl2N3O and a molecular weight of 192.00 g/mol. IUPAC name: 4,6-dichloropyridazine-3-carboxamide. InChIKey: WNBGORVZSVADSD-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 4,6-dichloropyridazine-3-carboxamide |
| InChIKey | WNBGORVZSVADSD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1Cl)C(=O)N)Cl |
Computed by PubChem (NCBI)