cas: 1818294-42-6 — see every product listed under this CAS number, including other names
4,7,10,13,16,19,22,25,28,31-Decaoxatritriacontanoic acid, 33-amino-, 1,1-dimethylethyl ester, 97% (CAS 1818294-42-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F862075-50MG |
| cas | 1818294-42-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 122.89 Pln | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 500mg | 570.65 Pln | |
| Fluorochem | 1g | 1091.30 Pln | |
| Fluorochem | 5g | 3637.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1818294-42-6) is a chemical compound with the molecular formula C27H55NO12 and a molecular weight of 585.7 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: CXGGTGCHTQMBOC-UHFFFAOYSA-N.
| Molecular formula | C27H55NO12 |
|---|---|
| Molecular weight | 585.7 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | CXGGTGCHTQMBOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)